C20H23FN2 — CID 124823609
(2S)-N-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methyl]butan-2-amine (PubChem CID 124823609) has the molecular formula C20H23FN2 and a molecular weight of 310.42 g/mol. Its IUPAC name is (2S)-N-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methyl]butan-2-amine.
| Compound Name | (2S)-N-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 124823609 |
| Molecular Formula | C20H23FN2 |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (2S)-N-[[1-[(2-fluorophenyl)methyl]indol-3-yl]methyl]butan-2-amine |
| SMILES | CC[C@H](C)NCc1cn(Cc2ccccc2F)c2ccccc12 |
| InChI | InChI=1S/C20H23FN2/c1-3-15(2)22-12-17-14-23(20-11-7-5-9-18(17)20)13-16-8-4-6-10-19(16)21/h4-11,14-15,22H,3,12-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | FYPDZASQSMQNGP-HNNXBMFYSA-N |
| XLogP | 4.72 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |