C27H27F2NO — CID 154688095
1-ethyl-2-fluorobenzene;4-[1-[(2-fluorophenyl)methyl]indol-3-yl]butanal (PubChem CID 154688095) has the molecular formula C27H27F2NO and a molecular weight of 419.52 g/mol. Its IUPAC name is 1-ethyl-2-fluorobenzene;4-[1-[(2-fluorophenyl)methyl]indol-3-yl]butanal.
| Compound Name | 1-ethyl-2-fluorobenzene;4-[1-[(2-fluorophenyl)methyl]indol-3-yl]butanal |
|---|---|
| PubChem CID | 154688095 |
| Molecular Formula | C27H27F2NO |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 1-ethyl-2-fluorobenzene;4-[1-[(2-fluorophenyl)methyl]indol-3-yl]butanal |
| SMILES | CCc1ccccc1F.O=CCCCc1cn(Cc2ccccc2F)c2ccccc12 |
| InChI | InChI=1S/C19H18FNO.C8H9F/c20-18-10-3-1-8-16(18)14-21-13-15(7-5-6-12-22)17-9-2-4-11-19(17)21;1-2-7-5-3-4-6-8(7)9/h1-4,8-13H,5-7,14H2;3-6H,2H2,1H3 |
| InChIKey | ICKPUKYGLYOLEF-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|