C25H30FNO2 — CID 154688189
6-[1-[(2-fluorophenyl)methyl]indol-3-yl]-1-(oxolan-2-yl)hexan-3-one;molecular hydrogen (PubChem CID 154688189) has the molecular formula C25H30FNO2 and a molecular weight of 395.52 g/mol. Its IUPAC name is 6-[1-[(2-fluorophenyl)methyl]indol-3-yl]-1-(oxolan-2-yl)hexan-3-one;molecular hydrogen.
| Compound Name | 6-[1-[(2-fluorophenyl)methyl]indol-3-yl]-1-(oxolan-2-yl)hexan-3-one;molecular hydrogen |
|---|---|
| PubChem CID | 154688189 |
| Molecular Formula | C25H30FNO2 |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 6-[1-[(2-fluorophenyl)methyl]indol-3-yl]-1-(oxolan-2-yl)hexan-3-one;molecular hydrogen |
| SMILES | O=C(CCCc1cn(Cc2ccccc2F)c2ccccc12)CCC1CCCO1.[H][H] |
| InChI | InChI=1S/C25H28FNO2.H2/c26-24-12-3-1-7-20(24)18-27-17-19(23-11-2-4-13-25(23)27)8-5-9-21(28)14-15-22-10-6-16-29-22;/h1-4,7,11-13,17,22H,5-6,8-10,14-16,18H2;1H |
| InChIKey | IXKLHEAHLCVWHH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |