C26H29NO2 — CID 154688061
2-ethylfuran;4-[1-[(3-methylphenyl)methyl]indol-3-yl]butanal (PubChem CID 154688061) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is 2-ethylfuran;4-[1-[(3-methylphenyl)methyl]indol-3-yl]butanal.
| Compound Name | 2-ethylfuran;4-[1-[(3-methylphenyl)methyl]indol-3-yl]butanal |
|---|---|
| PubChem CID | 154688061 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 2-ethylfuran;4-[1-[(3-methylphenyl)methyl]indol-3-yl]butanal |
| SMILES | CCc1ccco1.Cc1cccc(Cn2cc(CCCC=O)c3ccccc32)c1 |
| InChI | InChI=1S/C20H21NO.C6H8O/c1-16-7-6-8-17(13-16)14-21-15-18(9-4-5-12-22)19-10-2-3-11-20(19)21;1-2-6-4-3-5-7-6/h2-3,6-8,10-13,15H,4-5,9,14H2,1H3;3-5H,2H2,1H3 |
| InChIKey | IBPJFPKCWSXFKV-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|