C20H18N2O2S — CID 18973523
4-[[1-[(3-methylphenyl)methyl]indol-3-yl]methyl]-1,3-thiazolidine-2,5-dione (PubChem CID 18973523) has the molecular formula C20H18N2O2S and a molecular weight of 350.44 g/mol. Its IUPAC name is 4-[[1-[(3-methylphenyl)methyl]indol-3-yl]methyl]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[1-[(3-methylphenyl)methyl]indol-3-yl]methyl]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 18973523 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-[[1-[(3-methylphenyl)methyl]indol-3-yl]methyl]-1,3-thiazolidine-2,5-dione |
| SMILES | Cc1cccc(Cn2cc(CC3NC(=O)SC3=O)c3ccccc32)c1 |
| InChI | InChI=1S/C20H18N2O2S/c1-13-5-4-6-14(9-13)11-22-12-15(16-7-2-3-8-18(16)22)10-17-19(23)25-20(24)21-17/h2-9,12,17H,10-11H2,1H3,(H,21,24) |
| InChIKey | BDZSKVLIXXGKBJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|