C16H14N2O2S — CID 18973486
4-[(1-but-2-ynylindol-3-yl)methyl]-1,3-thiazolidine-2,5-dione (PubChem CID 18973486) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 4-[(1-but-2-ynylindol-3-yl)methyl]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[(1-but-2-ynylindol-3-yl)methyl]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 18973486 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-[(1-but-2-ynylindol-3-yl)methyl]-1,3-thiazolidine-2,5-dione |
| SMILES | CC#CCn1cc(CC2NC(=O)SC2=O)c2ccccc21 |
| InChI | InChI=1S/C16H14N2O2S/c1-2-3-8-18-10-11(12-6-4-5-7-14(12)18)9-13-15(19)21-16(20)17-13/h4-7,10,13H,8-9H2,1H3,(H,17,20) |
| InChIKey | MFMPYIMOUPWSOB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|