C25H22ClFN2O3 — CID 124823679
(10R,11R,15S,16R)-13-tert-butyl-16-(2-chlorobenzoyl)-5-fluoro-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 124823679) has the molecular formula C25H22ClFN2O3 and a molecular weight of 452.91 g/mol. Its IUPAC name is (10R,11R,15S,16R)-13-tert-butyl-16-(2-chlorobenzoyl)-5-fluoro-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10R,11R,15S,16R)-13-tert-butyl-16-(2-chlorobenzoyl)-5-fluoro-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 124823679 |
| Molecular Formula | C25H22ClFN2O3 |
| Molecular Weight | 452.91 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | (10R,11R,15S,16R)-13-tert-butyl-16-(2-chlorobenzoyl)-5-fluoro-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | CC(C)(C)N1C(=O)[C@@H]2[C@H](C1=O)[C@H](C(=O)c1ccccc1Cl)N1c3ccc(F)cc3C=C[C@H]21 |
| InChI | InChI=1S/C25H22ClFN2O3/c1-25(2,3)29-23(31)19-18-10-8-13-12-14(27)9-11-17(13)28(18)21(20(19)24(29)32)22(30)15-6-4-5-7-16(15)26/h4-12,18-21H,1-3H3/t18-,19+,20+,21-/m1/s1 |
| InChIKey | HMQDXAOLKZRNAW-IVAOSVALSA-N |
| XLogP | 4.35 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.91 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|