C23H27BrN2O3 — CID 100860148
(10R,11R,15R,16S)-5-bromo-13-tert-butyl-16-(2,2-dimethylpropanoyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 100860148) has the molecular formula C23H27BrN2O3 and a molecular weight of 459.38 g/mol. Its IUPAC name is (10R,11R,15R,16S)-5-bromo-13-tert-butyl-16-(2,2-dimethylpropanoyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10R,11R,15R,16S)-5-bromo-13-tert-butyl-16-(2,2-dimethylpropanoyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 100860148 |
| Molecular Formula | C23H27BrN2O3 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | (10R,11R,15R,16S)-5-bromo-13-tert-butyl-16-(2,2-dimethylpropanoyl)-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | CC(C)(C)C(=O)[C@@H]1[C@@H]2C(=O)N(C(C)(C)C)C(=O)[C@H]2[C@H]2C=Cc3cc(Br)ccc3N21 |
| InChI | InChI=1S/C23H27BrN2O3/c1-22(2,3)19(27)18-17-16(20(28)26(21(17)29)23(4,5)6)15-9-7-12-11-13(24)8-10-14(12)25(15)18/h7-11,15-18H,1-6H3/t15-,16+,17-,18+/m1/s1 |
| InChIKey | MUXVMEHGVBWLCR-XDNAFOTISA-N |
| XLogP | 4.05 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|