C20H22N2O3 — CID 51451863
(10R,11S,15S,16S)-16-(2,2-dimethylpropanoyl)-5-methyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione (PubChem CID 51451863) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is (10R,11S,15S,16S)-16-(2,2-dimethylpropanoyl)-5-methyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione.
| Compound Name | (10R,11S,15S,16S)-16-(2,2-dimethylpropanoyl)-5-methyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
|---|---|
| PubChem CID | 51451863 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (10R,11S,15S,16S)-16-(2,2-dimethylpropanoyl)-5-methyl-1,13-diazatetracyclo[8.6.0.02,7.011,15]hexadeca-2,4,6,8-tetraene-12,14-dione |
| SMILES | Cc1ccc2c(c1)C=C[C@@H]1[C@H]3C(=O)NC(=O)[C@@H]3[C@@H](C(=O)C(C)(C)C)N21 |
| InChI | InChI=1S/C20H22N2O3/c1-10-5-7-12-11(9-10)6-8-13-14-15(19(25)21-18(14)24)16(22(12)13)17(23)20(2,3)4/h5-9,13-16H,1-4H3,(H,21,24,25)/t13-,14-,15+,16+/m1/s1 |
| InChIKey | HSFCFAYTHGBKHB-WCVJEAGWSA-N |
| XLogP | 2.08 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|