C19H28N4O4S — CID 124823909
4-methyl-1-[(2S,6R)-12-morpholin-4-yl-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]pentan-1-one (PubChem CID 124823909) has the molecular formula C19H28N4O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is 4-methyl-1-[(2S,6R)-12-morpholin-4-yl-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]pentan-1-one.
| Compound Name | 4-methyl-1-[(2S,6R)-12-morpholin-4-yl-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]pentan-1-one |
|---|---|
| PubChem CID | 124823909 |
| Molecular Formula | C19H28N4O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 4-methyl-1-[(2S,6R)-12-morpholin-4-yl-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]pentan-1-one |
| SMILES | CC(C)CCC(=O)N1C[C@H]2c3nc(N4CCOCC4)ncc3CS(=O)(=O)[C@H]2C1 |
| InChI | InChI=1S/C19H28N4O4S/c1-13(2)3-4-17(24)23-10-15-16(11-23)28(25,26)12-14-9-20-19(21-18(14)15)22-5-7-27-8-6-22/h9,13,15-16H,3-8,10-12H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | BNSVCMMSFUJMSX-CVEARBPZSA-N |
| XLogP | 0.97 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |