C19H29N5O3S — CID 133136992
N,N-dimethyl-2-[(2S,6R)-12-(3-methylpiperidin-1-yl)-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]acetamide (PubChem CID 133136992) has the molecular formula C19H29N5O3S and a molecular weight of 407.54 g/mol. Its IUPAC name is N,N-dimethyl-2-[(2S,6R)-12-(3-methylpiperidin-1-yl)-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]acetamide.
| Compound Name | N,N-dimethyl-2-[(2S,6R)-12-(3-methylpiperidin-1-yl)-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]acetamide |
|---|---|
| PubChem CID | 133136992 |
| Molecular Formula | C19H29N5O3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N,N-dimethyl-2-[(2S,6R)-12-(3-methylpiperidin-1-yl)-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-4-yl]acetamide |
| SMILES | CC1CCCN(c2ncc3c(n2)[C@@H]2CN(CC(=O)N(C)C)C[C@@H]2S(=O)(=O)C3)C1 |
| InChI | InChI=1S/C19H29N5O3S/c1-13-5-4-6-24(8-13)19-20-7-14-12-28(26,27)16-10-23(11-17(25)22(2)3)9-15(16)18(14)21-19/h7,13,15-16H,4-6,8-12H2,1-3H3/t13?,15-,16+/m1/s1 |
| InChIKey | SXATYYNHLCYEGM-CZVYVAOFSA-N |
| XLogP | 0.50 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |