C23H30N4O2S — CID 134690434
(2R,6R)-4-[(3-methylphenyl)methyl]-12-(3-methylpiperidin-1-yl)-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene 7,7-dioxide (PubChem CID 134690434) has the molecular formula C23H30N4O2S and a molecular weight of 426.59 g/mol. Its IUPAC name is (2R,6R)-4-[(3-methylphenyl)methyl]-12-(3-methylpiperidin-1-yl)-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene 7,7-dioxide.
| Compound Name | (2R,6R)-4-[(3-methylphenyl)methyl]-12-(3-methylpiperidin-1-yl)-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene 7,7-dioxide |
|---|---|
| PubChem CID | 134690434 |
| Molecular Formula | C23H30N4O2S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | (2R,6R)-4-[(3-methylphenyl)methyl]-12-(3-methylpiperidin-1-yl)-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-triene 7,7-dioxide |
| SMILES | Cc1cccc(CN2C[C@@H]3c4nc(N5CCCC(C)C5)ncc4CS(=O)(=O)[C@H]3C2)c1 |
| InChI | InChI=1S/C23H30N4O2S/c1-16-5-3-7-18(9-16)12-26-13-20-21(14-26)30(28,29)15-19-10-24-23(25-22(19)20)27-8-4-6-17(2)11-27/h3,5,7,9-10,17,20-21H,4,6,8,11-15H2,1-2H3/t17?,20-,21-/m0/s1 |
| InChIKey | JOJUSWBOVWXJML-FUKGKQRISA-N |
| XLogP | 2.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |