C18H28N4O3 — CID 97453696
2-methyl-2-[2-[(3R)-3-methylpiperidin-1-yl]-4-morpholin-4-ylpyrimidin-5-yl]propanoic acid (PubChem CID 97453696) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-methyl-2-[2-[(3R)-3-methylpiperidin-1-yl]-4-morpholin-4-ylpyrimidin-5-yl]propanoic acid.
| Compound Name | 2-methyl-2-[2-[(3R)-3-methylpiperidin-1-yl]-4-morpholin-4-ylpyrimidin-5-yl]propanoic acid |
|---|---|
| PubChem CID | 97453696 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 2-methyl-2-[2-[(3R)-3-methylpiperidin-1-yl]-4-morpholin-4-ylpyrimidin-5-yl]propanoic acid |
| SMILES | C[C@@H]1CCCN(c2ncc(C(C)(C)C(=O)O)c(N3CCOCC3)n2)C1 |
| InChI | InChI=1S/C18H28N4O3/c1-13-5-4-6-22(12-13)17-19-11-14(18(2,3)16(23)24)15(20-17)21-7-9-25-10-8-21/h11,13H,4-10,12H2,1-3H3,(H,23,24)/t13-/m1/s1 |
| InChIKey | RSTRSMQXZZDCDD-CYBMUJFWSA-N |
| XLogP | 1.91 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |