C26H33FN4O — CID 124825915
N-butyl-N-ethyl-1-[[1-(4-fluorophenyl)benzimidazol-2-yl]methyl]piperidine-4-carboxamide (PubChem CID 124825915) has the molecular formula C26H33FN4O and a molecular weight of 436.58 g/mol. Its IUPAC name is N-butyl-N-ethyl-1-[[1-(4-fluorophenyl)benzimidazol-2-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-butyl-N-ethyl-1-[[1-(4-fluorophenyl)benzimidazol-2-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 124825915 |
| Molecular Formula | C26H33FN4O |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | N-butyl-N-ethyl-1-[[1-(4-fluorophenyl)benzimidazol-2-yl]methyl]piperidine-4-carboxamide |
| SMILES | CCCCN(CC)C(=O)C1CCN(Cc2nc3ccccc3n2-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H33FN4O/c1-3-5-16-30(4-2)26(32)20-14-17-29(18-15-20)19-25-28-23-8-6-7-9-24(23)31(25)22-12-10-21(27)11-13-22/h6-13,20H,3-5,14-19H2,1-2H3 |
| InChIKey | WIRZQAXYJARBJM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |