C32H35NO5S — CID 124826861
ethyl (1R,2R,9R,12S)-16-methoxy-6-[(4-methoxybenzoyl)amino]-9-methyl-5-thiapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),6,13(18),14,16-pentaene-7-carboxylate (PubChem CID 124826861) has the molecular formula C32H35NO5S and a molecular weight of 545.70 g/mol. Its IUPAC name is ethyl (1R,2R,9R,12S)-16-methoxy-6-[(4-methoxybenzoyl)amino]-9-methyl-5-thiapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),6,13(18),14,16-pentaene-7-carboxylate.
| Compound Name | ethyl (1R,2R,9R,12S)-16-methoxy-6-[(4-methoxybenzoyl)amino]-9-methyl-5-thiapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),6,13(18),14,16-pentaene-7-carboxylate |
|---|---|
| PubChem CID | 124826861 |
| Molecular Formula | C32H35NO5S |
| Molecular Weight | 545.70 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | ethyl (1R,2R,9R,12S)-16-methoxy-6-[(4-methoxybenzoyl)amino]-9-methyl-5-thiapentacyclo[10.8.0.02,9.04,8.013,18]icosa-4(8),6,13(18),14,16-pentaene-7-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(OC)cc2)sc2c1[C@]1(C)CC[C@@H]3c4ccc(OC)cc4CC[C@@H]3[C@H]1C2 |
| InChI | InChI=1S/C32H35NO5S/c1-5-38-31(35)27-28-26(39-30(27)33-29(34)18-6-9-20(36-3)10-7-18)17-25-24-12-8-19-16-21(37-4)11-13-22(19)23(24)14-15-32(25,28)2/h6-7,9-11,13,16,23-25H,5,8,12,14-15,17H2,1-4H3,(H,33,34)/t23-,24+,25-,32-/m1/s1 |
| InChIKey | XPYUQAJIUSIJHJ-PWRUDQNKSA-N |
| XLogP | 6.76 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.70 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |