C18H26N4O — CID 124827378
(2R)-1-[methyl-[(3S)-1-phenylpiperidin-3-yl]amino]-3-pyrazol-1-ylpropan-2-ol (PubChem CID 124827378) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is (2R)-1-[methyl-[(3S)-1-phenylpiperidin-3-yl]amino]-3-pyrazol-1-ylpropan-2-ol.
| Compound Name | (2R)-1-[methyl-[(3S)-1-phenylpiperidin-3-yl]amino]-3-pyrazol-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 124827378 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (2R)-1-[methyl-[(3S)-1-phenylpiperidin-3-yl]amino]-3-pyrazol-1-ylpropan-2-ol |
| SMILES | CN(C[C@@H](O)Cn1cccn1)[C@H]1CCCN(c2ccccc2)C1 |
| InChI | InChI=1S/C18H26N4O/c1-20(14-18(23)15-22-12-6-10-19-22)17-9-5-11-21(13-17)16-7-3-2-4-8-16/h2-4,6-8,10,12,17-18,23H,5,9,11,13-15H2,1H3/t17-,18+/m0/s1 |
| InChIKey | GHNVOZNGXVHFIT-ZWKOTPCHSA-N |
| XLogP | 1.84 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |