About (5-cyclopropyl-1,2-oxazol-3-yl)-[(7R)-7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone
(5-cyclopropyl-1,2-oxazol-3-yl)-[(7R)-7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone (PubChem CID 124828294) has the molecular formula C15H20N2O3S
and a molecular weight of 308.40 g/mol. Its IUPAC name is (5-cyclopropyl-1,2-oxazol-3-yl)-[(7R)-7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone.
Molecular Properties
| Compound Name | (5-cyclopropyl-1,2-oxazol-3-yl)-[(7R)-7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone |
| PubChem CID | 124828294 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (5-cyclopropyl-1,2-oxazol-3-yl)-[(7R)-7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone |
| SMILES | CCO[C@H]1CSC2(C1)CN(C(=O)c1cc(C3CC3)on1)C2 |
| InChI | InChI=1S/C15H20N2O3S/c1-2-19-11-6-15(21-7-11)8-17(9-15)14(18)12-5-13(20-16-12)10-3-4-10/h5,10-11H,2-4,6-9H2,1H3/t11-/m1/s1 |
| InChIKey | JAJMGDICHVRGDD-LLVKDONJSA-N |
| XLogP | 2.29 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-cyclopropyl-1,2-oxazol-3-yl)-[(7R)-7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyclopropyl-1,2-oxazol-3-yl)-[(7R)-7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone?
The IUPAC name of (5-cyclopropyl-1,2-oxazol-3-yl)-[(7R)-7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone (CID 124828294) is (5-cyclopropyl-1,2-oxazol-3-yl)-[(7R)-7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone.
What is the SMILES notation for (5-cyclopropyl-1,2-oxazol-3-yl)-[(7R)-7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone?
The canonical SMILES for (5-cyclopropyl-1,2-oxazol-3-yl)-[(7R)-7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone is CCO[C@H]1CSC2(C1)CN(C(=O)c1cc(C3CC3)on1)C2.
What is the InChIKey of (5-cyclopropyl-1,2-oxazol-3-yl)-[(7R)-7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone?
The InChIKey is JAJMGDICHVRGDD-LLVKDONJSA-N. The full InChI is InChI=1S/C15H20N2O3S/c1-2-19-11-6-15(21-7-11)8-17(9-15)14(18)12-5-13(20-16-12)10-3-4-10/h5,10-11H,2-4,6-9H2,1H3/t11-/m1/s1.
What are the key properties of (5-cyclopropyl-1,2-oxazol-3-yl)-[(7R)-7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone?
(5-cyclopropyl-1,2-oxazol-3-yl)-[(7R)-7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone has a molecular weight of 308.40 g/mol, XLogP of 2.29, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyclopropyl-1,2-oxazol-3-yl)-[(7R)-7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl]methanone is sourced from PubChem (CID 124828294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).