C16H20FNO3S — CID 131661221
(7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl)-(3-fluoro-4-methoxyphenyl)methanone (PubChem CID 131661221) has the molecular formula C16H20FNO3S and a molecular weight of 325.41 g/mol. Its IUPAC name is (7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl)-(3-fluoro-4-methoxyphenyl)methanone.
| Compound Name | (7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl)-(3-fluoro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 131661221 |
| Molecular Formula | C16H20FNO3S |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (7-ethoxy-5-thia-2-azaspiro[3.4]octan-2-yl)-(3-fluoro-4-methoxyphenyl)methanone |
| SMILES | CCOC1CSC2(C1)CN(C(=O)c1ccc(OC)c(F)c1)C2 |
| InChI | InChI=1S/C16H20FNO3S/c1-3-21-12-7-16(22-8-12)9-18(10-16)15(19)11-4-5-14(20-2)13(17)6-11/h4-6,12H,3,7-10H2,1-2H3 |
| InChIKey | SPYOQKRDRBGFGM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |