C15H21NO3S — CID 124828538
1-[(8S)-8-ethoxy-5-oxa-2-azaspiro[3.5]nonan-2-yl]-2-thiophen-2-ylethanone (PubChem CID 124828538) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is 1-[(8S)-8-ethoxy-5-oxa-2-azaspiro[3.5]nonan-2-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[(8S)-8-ethoxy-5-oxa-2-azaspiro[3.5]nonan-2-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 124828538 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-[(8S)-8-ethoxy-5-oxa-2-azaspiro[3.5]nonan-2-yl]-2-thiophen-2-ylethanone |
| SMILES | CCO[C@H]1CCOC2(C1)CN(C(=O)Cc1cccs1)C2 |
| InChI | InChI=1S/C15H21NO3S/c1-2-18-12-5-6-19-15(9-12)10-16(11-15)14(17)8-13-4-3-7-20-13/h3-4,7,12H,2,5-6,8-11H2,1H3/t12-/m0/s1 |
| InChIKey | PZTOSFRLPXISMD-LBPRGKRZSA-N |
| XLogP | 2.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |