C20H31N3O3 — CID 124828678
2-[4-[[(2R)-1-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-1-oxopropan-2-yl]amino]phenoxy]-N-ethylacetamide (PubChem CID 124828678) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-[4-[[(2R)-1-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-1-oxopropan-2-yl]amino]phenoxy]-N-ethylacetamide.
| Compound Name | 2-[4-[[(2R)-1-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-1-oxopropan-2-yl]amino]phenoxy]-N-ethylacetamide |
|---|---|
| PubChem CID | 124828678 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 2-[4-[[(2R)-1-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-1-oxopropan-2-yl]amino]phenoxy]-N-ethylacetamide |
| SMILES | CCNC(=O)COc1ccc(N[C@H](C)C(=O)N2[C@H](C)CCC[C@H]2C)cc1 |
| InChI | InChI=1S/C20H31N3O3/c1-5-21-19(24)13-26-18-11-9-17(10-12-18)22-16(4)20(25)23-14(2)7-6-8-15(23)3/h9-12,14-16,22H,5-8,13H2,1-4H3,(H,21,24)/t14-,15-,16-/m1/s1 |
| InChIKey | VOIQIOIHYQTKIE-BZUAXINKSA-N |
| XLogP | 2.79 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|