C15H30N2O3 — CID 124829213
1,3-bis[(2S)-2-methyl-1,4-oxazepan-4-yl]propan-2-ol (PubChem CID 124829213) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is 1,3-bis[(2S)-2-methyl-1,4-oxazepan-4-yl]propan-2-ol.
| Compound Name | 1,3-bis[(2S)-2-methyl-1,4-oxazepan-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 124829213 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 1,3-bis[(2S)-2-methyl-1,4-oxazepan-4-yl]propan-2-ol |
| SMILES | C[C@H]1CN(CC(O)CN2CCCO[C@@H](C)C2)CCCO1 |
| InChI | InChI=1S/C15H30N2O3/c1-13-9-16(5-3-7-19-13)11-15(18)12-17-6-4-8-20-14(2)10-17/h13-15,18H,3-12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | CBLVTADOECZGGK-KBPBESRZSA-N |
| XLogP | 0.57 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |