C12H26N2O2 — CID 64897757
3-(ethylamino)-4-(2-methyl-1,4-oxazepan-4-yl)butan-1-ol (PubChem CID 64897757) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-(ethylamino)-4-(2-methyl-1,4-oxazepan-4-yl)butan-1-ol.
| Compound Name | 3-(ethylamino)-4-(2-methyl-1,4-oxazepan-4-yl)butan-1-ol |
|---|---|
| PubChem CID | 64897757 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 3-(ethylamino)-4-(2-methyl-1,4-oxazepan-4-yl)butan-1-ol |
| SMILES | CCNC(CCO)CN1CCCOC(C)C1 |
| InChI | InChI=1S/C12H26N2O2/c1-3-13-12(5-7-15)10-14-6-4-8-16-11(2)9-14/h11-13,15H,3-10H2,1-2H3 |
| InChIKey | DTGSBPVOXIQDOH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |