C11H24N2O2 — CID 64897760
3-(ethylamino)-4-(1,4-oxazepan-4-yl)butan-1-ol (PubChem CID 64897760) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 3-(ethylamino)-4-(1,4-oxazepan-4-yl)butan-1-ol.
| Compound Name | 3-(ethylamino)-4-(1,4-oxazepan-4-yl)butan-1-ol |
|---|---|
| PubChem CID | 64897760 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 3-(ethylamino)-4-(1,4-oxazepan-4-yl)butan-1-ol |
| SMILES | CCNC(CCO)CN1CCCOCC1 |
| InChI | InChI=1S/C11H24N2O2/c1-2-12-11(4-7-14)10-13-5-3-8-15-9-6-13/h11-12,14H,2-10H2,1H3 |
| InChIKey | DIPSAFPPXXQYHB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |