2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid

C10H19NO4 — CID 63073024

IUPAC2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid
SMILESCCOC(CN1CCCOCC1)C(=O)O
InChIInChI=1S/C10H19NO4/c1-2-15-9(10(12)13)8-11-4-3-6-14-7-5-11/h9H,2-8H2,1H3,(H,12,13)
InChIKeyRYLRANNXCBSDFT-UHFFFAOYSA-N
MW217.26 g/mol
LogP0.20
Rot. Bonds5

About 2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid

2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid (PubChem CID 63073024) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid.

Molecular Properties

Compound Name2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid
PubChem CID63073024
Molecular FormulaC10H19NO4
Molecular Weight217.26 g/mol
Exact Mass217.13
IUPAC Name2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid
SMILESCCOC(CN1CCCOCC1)C(=O)O
InChIInChI=1S/C10H19NO4/c1-2-15-9(10(12)13)8-11-4-3-6-14-7-5-11/h9H,2-8H2,1H3,(H,12,13)
InChIKeyRYLRANNXCBSDFT-UHFFFAOYSA-N
XLogP0.20
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.26
LogP ≤ 50.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid?
The IUPAC name of 2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid (CID 63073024) is 2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid.
What is the SMILES notation for 2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid?
The canonical SMILES for 2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid is CCOC(CN1CCCOCC1)C(=O)O.
What is the InChIKey of 2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid?
The InChIKey is RYLRANNXCBSDFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4/c1-2-15-9(10(12)13)8-11-4-3-6-14-7-5-11/h9H,2-8H2,1H3,(H,12,13).
What are the key properties of 2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid?
2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid has a molecular weight of 217.26 g/mol, XLogP of 0.20, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3-(1,4-oxazepan-4-yl)propanoic acid is sourced from PubChem (CID 63073024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).