C12H23NO2 — CID 165399162
(2S)-2,4-dimethyl-1-morpholin-4-ylhexan-3-one (PubChem CID 165399162) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is (2S)-2,4-dimethyl-1-morpholin-4-ylhexan-3-one.
| Compound Name | (2S)-2,4-dimethyl-1-morpholin-4-ylhexan-3-one |
|---|---|
| PubChem CID | 165399162 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (2S)-2,4-dimethyl-1-morpholin-4-ylhexan-3-one |
| SMILES | CCC(C)C(=O)[C@@H](C)CN1CCOCC1 |
| InChI | InChI=1S/C12H23NO2/c1-4-10(2)12(14)11(3)9-13-5-7-15-8-6-13/h10-11H,4-9H2,1-3H3/t10?,11-/m0/s1 |
| InChIKey | BDFFPCDXHFAWFF-DTIOYNMSSA-N |
| XLogP | 1.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |