C17H31N3O4 — CID 124831975
tert-butyl N-[(3R)-1-[[(1S)-1-[(2R)-oxolan-2-yl]ethyl]carbamoyl]piperidin-3-yl]carbamate (PubChem CID 124831975) has the molecular formula C17H31N3O4 and a molecular weight of 341.45 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[[(1S)-1-[(2R)-oxolan-2-yl]ethyl]carbamoyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[[(1S)-1-[(2R)-oxolan-2-yl]ethyl]carbamoyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 124831975 |
| Molecular Formula | C17H31N3O4 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | tert-butyl N-[(3R)-1-[[(1S)-1-[(2R)-oxolan-2-yl]ethyl]carbamoyl]piperidin-3-yl]carbamate |
| SMILES | C[C@H](NC(=O)N1CCC[C@@H](NC(=O)OC(C)(C)C)C1)[C@H]1CCCO1 |
| InChI | InChI=1S/C17H31N3O4/c1-12(14-8-6-10-23-14)18-15(21)20-9-5-7-13(11-20)19-16(22)24-17(2,3)4/h12-14H,5-11H2,1-4H3,(H,18,21)(H,19,22)/t12-,13+,14+/m0/s1 |
| InChIKey | FNCCJTWENQJRAA-BFHYXJOUSA-N |
| XLogP | 2.25 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |