C37H37F2N5O3 — CID 124834003
2,6-difluoro-N-[5-[(3R)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]benzamide (PubChem CID 124834003) has the molecular formula C37H37F2N5O3 and a molecular weight of 637.73 g/mol. Its IUPAC name is 2,6-difluoro-N-[5-[(3R)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]benzamide.
| Compound Name | 2,6-difluoro-N-[5-[(3R)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 124834003 |
| Molecular Formula | C37H37F2N5O3 |
| Molecular Weight | 637.73 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | 2,6-difluoro-N-[5-[(3R)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]benzamide |
| SMILES | Cc1cccc(N2CCN(C(=O)c3ccc(N4C[C@H]5C[C@@H](C4)c4cccc(=O)n4C5)c(NC(=O)c4c(F)cccc4F)c3)C[C@H]2C)c1 |
| InChI | InChI=1S/C37H37F2N5O3/c1-23-6-3-7-28(16-23)43-15-14-41(19-24(43)2)37(47)26-12-13-33(31(18-26)40-36(46)35-29(38)8-4-9-30(35)39)42-20-25-17-27(22-42)32-10-5-11-34(45)44(32)21-25/h3-13,16,18,24-25,27H,14-15,17,19-22H2,1-2H3,(H,40,46)/t24-,25-,27+/m1/s1 |
| InChIKey | CFDQXKGAJHNDMD-SLQPCKNISA-N |
| XLogP | 5.66 |
| TPSA | 77.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.73 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |