C39H41N5O3 — CID 129430866
(E)-N-[5-[(3S)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]-3-phenylprop-2-enamide (PubChem CID 129430866) has the molecular formula C39H41N5O3 and a molecular weight of 627.79 g/mol. Its IUPAC name is (E)-N-[5-[(3S)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[5-[(3S)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 129430866 |
| Molecular Formula | C39H41N5O3 |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.32 |
| IUPAC Name | (E)-N-[5-[(3S)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]-3-phenylprop-2-enamide |
| SMILES | Cc1cccc(N2CCN(C(=O)c3ccc(N4C[C@H]5C[C@@H](C4)c4cccc(=O)n4C5)c(NC(=O)/C=C/c4ccccc4)c3)C[C@@H]2C)c1 |
| InChI | InChI=1S/C39H41N5O3/c1-27-8-6-11-33(20-27)43-19-18-41(23-28(43)2)39(47)31-15-16-36(34(22-31)40-37(45)17-14-29-9-4-3-5-10-29)42-24-30-21-32(26-42)35-12-7-13-38(46)44(35)25-30/h3-17,20,22,28,30,32H,18-19,21,23-26H2,1-2H3,(H,40,45)/b17-14+/t28-,30+,32-/m0/s1 |
| InChIKey | YANFLQIGPOMVIS-QJLZZKSHSA-N |
| XLogP | 5.78 |
| TPSA | 77.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|