C30H32N4O4 — CID 5070671
N-(2-methoxyethyl)-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)-3-(3-phenylprop-2-enoylamino)benzamide (PubChem CID 5070671) has the molecular formula C30H32N4O4 and a molecular weight of 512.61 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)-3-(3-phenylprop-2-enoylamino)benzamide.
| Compound Name | N-(2-methoxyethyl)-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)-3-(3-phenylprop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 5070671 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | N-(2-methoxyethyl)-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)-3-(3-phenylprop-2-enoylamino)benzamide |
| SMILES | COCCNC(=O)c1ccc(N2CC3CC(C2)c2cccc(=O)n2C3)c(NC(=O)C=Cc2ccccc2)c1 |
| InChI | InChI=1S/C30H32N4O4/c1-38-15-14-31-30(37)23-11-12-27(25(17-23)32-28(35)13-10-21-6-3-2-4-7-21)33-18-22-16-24(20-33)26-8-5-9-29(36)34(26)19-22/h2-13,17,22,24H,14-16,18-20H2,1H3,(H,31,37)(H,32,35) |
| InChIKey | KMSDKLNDMMZTPN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|