C30H35N5O2S — CID 3358252
N-butyl-3-[(4-methylphenyl)carbamothioylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide (PubChem CID 3358252) has the molecular formula C30H35N5O2S and a molecular weight of 529.71 g/mol. Its IUPAC name is N-butyl-3-[(4-methylphenyl)carbamothioylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide.
| Compound Name | N-butyl-3-[(4-methylphenyl)carbamothioylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide |
|---|---|
| PubChem CID | 3358252 |
| Molecular Formula | C30H35N5O2S |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | N-butyl-3-[(4-methylphenyl)carbamothioylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide |
| SMILES | CCCCNC(=O)c1ccc(N2CC3CC(C2)c2cccc(=O)n2C3)c(NC(=S)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C30H35N5O2S/c1-3-4-14-31-29(37)22-10-13-27(25(16-22)33-30(38)32-24-11-8-20(2)9-12-24)34-17-21-15-23(19-34)26-6-5-7-28(36)35(26)18-21/h5-13,16,21,23H,3-4,14-15,17-19H2,1-2H3,(H,31,37)(H2,32,33,38) |
| InChIKey | HOYFOORZKDLBSC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 78.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|