C28H31ClN4O4S — CID 3681255
N-butyl-3-[(4-chlorophenyl)sulfonylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide (PubChem CID 3681255) has the molecular formula C28H31ClN4O4S and a molecular weight of 555.10 g/mol. Its IUPAC name is N-butyl-3-[(4-chlorophenyl)sulfonylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide.
| Compound Name | N-butyl-3-[(4-chlorophenyl)sulfonylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide |
|---|---|
| PubChem CID | 3681255 |
| Molecular Formula | C28H31ClN4O4S |
| Molecular Weight | 555.10 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | N-butyl-3-[(4-chlorophenyl)sulfonylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide |
| SMILES | CCCCNC(=O)c1ccc(N2CC3CC(C2)c2cccc(=O)n2C3)c(NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C28H31ClN4O4S/c1-2-3-13-30-28(35)20-7-12-26(24(15-20)31-38(36,37)23-10-8-22(29)9-11-23)32-16-19-14-21(18-32)25-5-4-6-27(34)33(25)17-19/h4-12,15,19,21,31H,2-3,13-14,16-18H2,1H3,(H,30,35) |
| InChIKey | DUDLAWYWTSZTRN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.10 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|