C28H30ClN4O4S- — CID 3681254
N-butyl-3-[(4-chlorophenyl)sulfonylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzenecarboximidate (PubChem CID 3681254) has the molecular formula C28H30ClN4O4S- and a molecular weight of 554.09 g/mol. Its IUPAC name is N-butyl-3-[(4-chlorophenyl)sulfonylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzenecarboximidate.
| Compound Name | N-butyl-3-[(4-chlorophenyl)sulfonylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzenecarboximidate |
|---|---|
| PubChem CID | 3681254 |
| Molecular Formula | C28H30ClN4O4S- |
| Molecular Weight | 554.09 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | N-butyl-3-[(4-chlorophenyl)sulfonylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzenecarboximidate |
| SMILES | CCCC/N=C(\[O-])c1ccc(N2CC3CC(C2)c2cccc(=O)n2C3)c(NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C28H31ClN4O4S/c1-2-3-13-30-28(35)20-7-12-26(24(15-20)31-38(36,37)23-10-8-22(29)9-11-23)32-16-19-14-21(18-32)25-5-4-6-27(34)33(25)17-19/h4-12,15,19,21,31H,2-3,13-14,16-18H2,1H3,(H,30,35)/p-1 |
| InChIKey | DUDLAWYWTSZTRN-UHFFFAOYSA-M |
| XLogP | 3.83 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.09 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|