C32H35ClN4O4S — CID 98363105
3-[(4-chlorophenyl)sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzamide (PubChem CID 98363105) has the molecular formula C32H35ClN4O4S and a molecular weight of 607.18 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzamide.
| Compound Name | 3-[(4-chlorophenyl)sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzamide |
|---|---|
| PubChem CID | 98363105 |
| Molecular Formula | C32H35ClN4O4S |
| Molecular Weight | 607.18 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylamino]-N-[2-(cyclohexen-1-yl)ethyl]-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzamide |
| SMILES | O=C(NCCC1=CCCCC1)c1ccc(N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)c(NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C32H35ClN4O4S/c33-26-10-12-27(13-11-26)42(40,41)35-28-18-24(32(39)34-16-15-22-5-2-1-3-6-22)9-14-30(28)36-19-23-17-25(21-36)29-7-4-8-31(38)37(29)20-23/h4-5,7-14,18,23,25,35H,1-3,6,15-17,19-21H2,(H,34,39)/t23-,25+/m1/s1 |
| InChIKey | OOTWDVYYVWPCIK-NOZRDPDXSA-N |
| XLogP | 5.55 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.18 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|