C36H36N4O5 — CID 4067328
N-[5-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)phenyl]-2-oxochromene-3-carboxamide (PubChem CID 4067328) has the molecular formula C36H36N4O5 and a molecular weight of 604.71 g/mol. Its IUPAC name is N-[5-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[5-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 4067328 |
| Molecular Formula | C36H36N4O5 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | N-[5-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)phenyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1ccc(N2CC3CC(C2)c2cccc(=O)n2C3)c(NC(=O)c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C36H36N4O5/c41-33-12-6-10-30-27-17-24(21-40(30)33)20-39(22-27)31-14-13-26(34(42)37-16-15-23-7-2-1-3-8-23)19-29(31)38-35(43)28-18-25-9-4-5-11-32(25)45-36(28)44/h4-7,9-14,18-19,24,27H,1-3,8,15-17,20-22H2,(H,37,42)(H,38,43) |
| InChIKey | LCRFGCUTDCAHRG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|