C36H42N4O6 — CID 23936784
N-[5-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 23936784) has the molecular formula C36H42N4O6 and a molecular weight of 626.75 g/mol. Its IUPAC name is N-[5-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[5-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 23936784 |
| Molecular Formula | C36H42N4O6 |
| Molecular Weight | 626.75 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | N-[5-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2cc(C(=O)NCCC3=CCCCC3)ccc2N2CC3CC(C2)c2cccc(=O)n2C3)cc(OC)c1OC |
| InChI | InChI=1S/C36H42N4O6/c1-44-31-18-26(19-32(45-2)34(31)46-3)36(43)38-28-17-25(35(42)37-15-14-23-8-5-4-6-9-23)12-13-30(28)39-20-24-16-27(22-39)29-10-7-11-33(41)40(29)21-24/h7-8,10-13,17-19,24,27H,4-6,9,14-16,20-22H2,1-3H3,(H,37,42)(H,38,43) |
| InChIKey | FEYLMVXHJKOYAI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.75 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|