C35H35N5O4S — CID 46371962
N-(1,3-benzodioxol-5-ylmethyl)-3-[(3,5-dimethylphenyl)carbamothioylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide (PubChem CID 46371962) has the molecular formula C35H35N5O4S and a molecular weight of 621.76 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-[(3,5-dimethylphenyl)carbamothioylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[(3,5-dimethylphenyl)carbamothioylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide |
|---|---|
| PubChem CID | 46371962 |
| Molecular Formula | C35H35N5O4S |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[(3,5-dimethylphenyl)carbamothioylamino]-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide |
| SMILES | Cc1cc(C)cc(NC(=S)Nc2cc(C(=O)NCc3ccc4c(c3)OCO4)ccc2N2CC3CC(C2)c2cccc(=O)n2C3)c1 |
| InChI | InChI=1S/C35H35N5O4S/c1-21-10-22(2)12-27(11-21)37-35(45)38-28-15-25(34(42)36-16-23-6-9-31-32(14-23)44-20-43-31)7-8-30(28)39-17-24-13-26(19-39)29-4-3-5-33(41)40(29)18-24/h3-12,14-15,24,26H,13,16-20H2,1-2H3,(H,36,42)(H2,37,38,45) |
| InChIKey | LKXXOGSDFQTKBJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|