C26H22N4O4 — CID 3305556
N-[3-cyano-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 3305556) has the molecular formula C26H22N4O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is N-[3-cyano-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-cyano-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3305556 |
| Molecular Formula | C26H22N4O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | N-[3-cyano-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | N#Cc1cc(NC(=O)c2ccc3c(c2)OCO3)ccc1N1CC2CC(C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C26H22N4O4/c27-11-18-9-20(28-26(32)17-4-7-23-24(10-17)34-15-33-23)5-6-21(18)29-12-16-8-19(14-29)22-2-1-3-25(31)30(22)13-16/h1-7,9-10,16,19H,8,12-15H2,(H,28,32) |
| InChIKey | HBTCZCQJPPJMJP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|