C31H37N5O3S — CID 3672579
3-[(3,5-dimethylphenyl)carbamothioylamino]-N-(3-methoxypropyl)-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide (PubChem CID 3672579) has the molecular formula C31H37N5O3S and a molecular weight of 559.74 g/mol. Its IUPAC name is 3-[(3,5-dimethylphenyl)carbamothioylamino]-N-(3-methoxypropyl)-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide.
| Compound Name | 3-[(3,5-dimethylphenyl)carbamothioylamino]-N-(3-methoxypropyl)-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide |
|---|---|
| PubChem CID | 3672579 |
| Molecular Formula | C31H37N5O3S |
| Molecular Weight | 559.74 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | 3-[(3,5-dimethylphenyl)carbamothioylamino]-N-(3-methoxypropyl)-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide |
| SMILES | COCCCNC(=O)c1ccc(N2CC3CC(C2)c2cccc(=O)n2C3)c(NC(=S)Nc2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C31H37N5O3S/c1-20-12-21(2)14-25(13-20)33-31(40)34-26-16-23(30(38)32-10-5-11-39-3)8-9-28(26)35-17-22-15-24(19-35)27-6-4-7-29(37)36(27)18-22/h4,6-9,12-14,16,22,24H,5,10-11,15,17-19H2,1-3H3,(H,32,38)(H2,33,34,40) |
| InChIKey | MLINKAORJSOSLS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.74 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|