C31H40N4O6S — CID 99733932
3-[[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methylsulfonylamino]-N-(2-methoxyethyl)-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzamide (PubChem CID 99733932) has the molecular formula C31H40N4O6S and a molecular weight of 596.75 g/mol. Its IUPAC name is 3-[[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methylsulfonylamino]-N-(2-methoxyethyl)-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzamide.
| Compound Name | 3-[[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methylsulfonylamino]-N-(2-methoxyethyl)-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzamide |
|---|---|
| PubChem CID | 99733932 |
| Molecular Formula | C31H40N4O6S |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | 3-[[(1R,4S)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methylsulfonylamino]-N-(2-methoxyethyl)-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]benzamide |
| SMILES | COCCNC(=O)c1ccc(N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)c(NS(=O)(=O)C[C@@]23CC[C@@H](CC2=O)C3(C)C)c1 |
| InChI | InChI=1S/C31H40N4O6S/c1-30(2)23-9-10-31(30,27(36)15-23)19-42(39,40)33-24-14-21(29(38)32-11-12-41-3)7-8-26(24)34-16-20-13-22(18-34)25-5-4-6-28(37)35(25)17-20/h4-8,14,20,22-23,33H,9-13,15-19H2,1-3H3,(H,32,38)/t20-,22+,23+,31+/m1/s1 |
| InChIKey | XTSMHIRXICEYQX-GMPVAZGLSA-N |
| XLogP | 2.99 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|