C13H20N2O3S — CID 124838298
(3S,7aS)-7a-methyl-5-oxo-N-[[(2R)-oxolan-2-yl]methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 124838298) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is (3S,7aS)-7a-methyl-5-oxo-N-[[(2R)-oxolan-2-yl]methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3S,7aS)-7a-methyl-5-oxo-N-[[(2R)-oxolan-2-yl]methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 124838298 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (3S,7aS)-7a-methyl-5-oxo-N-[[(2R)-oxolan-2-yl]methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | C[C@]12CCC(=O)N1[C@@H](C(=O)NC[C@H]1CCCO1)CS2 |
| InChI | InChI=1S/C13H20N2O3S/c1-13-5-4-11(16)15(13)10(8-19-13)12(17)14-7-9-3-2-6-18-9/h9-10H,2-8H2,1H3,(H,14,17)/t9-,10-,13+/m1/s1 |
| InChIKey | VBTYGRFYSXTRIB-BREBYQMCSA-N |
| XLogP | 0.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |