C23H28FN3O2 — CID 124838994
N-[3-(N-ethylanilino)propyl]-5-fluoro-2-[[(1S,2R)-2-methylcyclopropanecarbonyl]amino]benzamide (PubChem CID 124838994) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is N-[3-(N-ethylanilino)propyl]-5-fluoro-2-[[(1S,2R)-2-methylcyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-[3-(N-ethylanilino)propyl]-5-fluoro-2-[[(1S,2R)-2-methylcyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 124838994 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-[3-(N-ethylanilino)propyl]-5-fluoro-2-[[(1S,2R)-2-methylcyclopropanecarbonyl]amino]benzamide |
| SMILES | CCN(CCCNC(=O)c1cc(F)ccc1NC(=O)[C@H]1C[C@H]1C)c1ccccc1 |
| InChI | InChI=1S/C23H28FN3O2/c1-3-27(18-8-5-4-6-9-18)13-7-12-25-22(28)20-15-17(24)10-11-21(20)26-23(29)19-14-16(19)2/h4-6,8-11,15-16,19H,3,7,12-14H2,1-2H3,(H,25,28)(H,26,29)/t16-,19+/m1/s1 |
| InChIKey | DWDALLUMPVYJHC-APWZRJJASA-N |
| XLogP | 4.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|