C22H25FN4O — CID 39644068
N-[3-(N-ethylanilino)propyl]-1-(4-fluorophenyl)-5-methylpyrazole-4-carboxamide (PubChem CID 39644068) has the molecular formula C22H25FN4O and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[3-(N-ethylanilino)propyl]-1-(4-fluorophenyl)-5-methylpyrazole-4-carboxamide.
| Compound Name | N-[3-(N-ethylanilino)propyl]-1-(4-fluorophenyl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 39644068 |
| Molecular Formula | C22H25FN4O |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N-[3-(N-ethylanilino)propyl]-1-(4-fluorophenyl)-5-methylpyrazole-4-carboxamide |
| SMILES | CCN(CCCNC(=O)c1cnn(-c2ccc(F)cc2)c1C)c1ccccc1 |
| InChI | InChI=1S/C22H25FN4O/c1-3-26(19-8-5-4-6-9-19)15-7-14-24-22(28)21-16-25-27(17(21)2)20-12-10-18(23)11-13-20/h4-6,8-13,16H,3,7,14-15H2,1-2H3,(H,24,28) |
| InChIKey | MNWDPUOVDLUJQJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|