C23H27FN4O — CID 46578214
N-[2-(diethylamino)-2-phenylethyl]-1-(4-fluorophenyl)-5-methylpyrazole-4-carboxamide (PubChem CID 46578214) has the molecular formula C23H27FN4O and a molecular weight of 394.49 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-phenylethyl]-1-(4-fluorophenyl)-5-methylpyrazole-4-carboxamide.
| Compound Name | N-[2-(diethylamino)-2-phenylethyl]-1-(4-fluorophenyl)-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46578214 |
| Molecular Formula | C23H27FN4O |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | N-[2-(diethylamino)-2-phenylethyl]-1-(4-fluorophenyl)-5-methylpyrazole-4-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)c1cnn(-c2ccc(F)cc2)c1C)c1ccccc1 |
| InChI | InChI=1S/C23H27FN4O/c1-4-27(5-2)22(18-9-7-6-8-10-18)16-25-23(29)21-15-26-28(17(21)3)20-13-11-19(24)12-14-20/h6-15,22H,4-5,16H2,1-3H3,(H,25,29) |
| InChIKey | VWSDFQMLFYMGMH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |