C20H25N5OS — CID 60510440
N-[2-(diethylamino)-2-thiophen-3-ylethyl]-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide (PubChem CID 60510440) has the molecular formula C20H25N5OS and a molecular weight of 383.52 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-thiophen-3-ylethyl]-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide.
| Compound Name | N-[2-(diethylamino)-2-thiophen-3-ylethyl]-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 60510440 |
| Molecular Formula | C20H25N5OS |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-[2-(diethylamino)-2-thiophen-3-ylethyl]-5-methyl-1-pyridin-2-ylpyrazole-4-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)c1cnn(-c2ccccn2)c1C)c1ccsc1 |
| InChI | InChI=1S/C20H25N5OS/c1-4-24(5-2)18(16-9-11-27-14-16)13-22-20(26)17-12-23-25(15(17)3)19-8-6-7-10-21-19/h6-12,14,18H,4-5,13H2,1-3H3,(H,22,26) |
| InChIKey | SQCAKAKUWPZXEV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |