C18H24FN3O2 — CID 124844787
3-[(1S)-1-(3-fluoro-4-methylphenyl)ethyl]-1-methyl-1-[(3S)-2-oxo-1-prop-2-enylpyrrolidin-3-yl]urea (PubChem CID 124844787) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is 3-[(1S)-1-(3-fluoro-4-methylphenyl)ethyl]-1-methyl-1-[(3S)-2-oxo-1-prop-2-enylpyrrolidin-3-yl]urea.
| Compound Name | 3-[(1S)-1-(3-fluoro-4-methylphenyl)ethyl]-1-methyl-1-[(3S)-2-oxo-1-prop-2-enylpyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 124844787 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 3-[(1S)-1-(3-fluoro-4-methylphenyl)ethyl]-1-methyl-1-[(3S)-2-oxo-1-prop-2-enylpyrrolidin-3-yl]urea |
| SMILES | C=CCN1CC[C@H](N(C)C(=O)N[C@@H](C)c2ccc(C)c(F)c2)C1=O |
| InChI | InChI=1S/C18H24FN3O2/c1-5-9-22-10-8-16(17(22)23)21(4)18(24)20-13(3)14-7-6-12(2)15(19)11-14/h5-7,11,13,16H,1,8-10H2,2-4H3,(H,20,24)/t13-,16-/m0/s1 |
| InChIKey | GVRBLCGESQYBQN-BBRMVZONSA-N |
| XLogP | 2.62 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|