C21H26N2O2 — CID 124846210
N'-[(1R)-2-methyl-1-phenylpropyl]-N-[(1R)-1-phenylpropyl]oxamide (PubChem CID 124846210) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N'-[(1R)-2-methyl-1-phenylpropyl]-N-[(1R)-1-phenylpropyl]oxamide.
| Compound Name | N'-[(1R)-2-methyl-1-phenylpropyl]-N-[(1R)-1-phenylpropyl]oxamide |
|---|---|
| PubChem CID | 124846210 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N'-[(1R)-2-methyl-1-phenylpropyl]-N-[(1R)-1-phenylpropyl]oxamide |
| SMILES | CC[C@@H](NC(=O)C(=O)N[C@@H](c1ccccc1)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O2/c1-4-18(16-11-7-5-8-12-16)22-20(24)21(25)23-19(15(2)3)17-13-9-6-10-14-17/h5-15,18-19H,4H2,1-3H3,(H,22,24)(H,23,25)/t18-,19-/m1/s1 |
| InChIKey | IIXPALUCZKQOBF-RTBURBONSA-N |
| XLogP | 3.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|