About 3-[[2-[(3S)-3-ethyl-3-methylmorpholin-4-yl]acetyl]amino]-N,N-dimethylbenzamide
3-[[2-[(3S)-3-ethyl-3-methylmorpholin-4-yl]acetyl]amino]-N,N-dimethylbenzamide (PubChem CID 124846408) has the molecular formula C18H27N3O3
and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-[[2-[(3S)-3-ethyl-3-methylmorpholin-4-yl]acetyl]amino]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-[[2-[(3S)-3-ethyl-3-methylmorpholin-4-yl]acetyl]amino]-N,N-dimethylbenzamide |
| PubChem CID | 124846408 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 3-[[2-[(3S)-3-ethyl-3-methylmorpholin-4-yl]acetyl]amino]-N,N-dimethylbenzamide |
| SMILES | CC[C@@]1(C)COCCN1CC(=O)Nc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C18H27N3O3/c1-5-18(2)13-24-10-9-21(18)12-16(22)19-15-8-6-7-14(11-15)17(23)20(3)4/h6-8,11H,5,9-10,12-13H2,1-4H3,(H,19,22)/t18-/m0/s1 |
| InChIKey | ISRYWMCAZWQLJZ-SFHVURJKSA-N |
| XLogP | 1.83 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[2-[(3S)-3-ethyl-3-methylmorpholin-4-yl]acetyl]amino]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-[(3S)-3-ethyl-3-methylmorpholin-4-yl]acetyl]amino]-N,N-dimethylbenzamide?
The IUPAC name of 3-[[2-[(3S)-3-ethyl-3-methylmorpholin-4-yl]acetyl]amino]-N,N-dimethylbenzamide (CID 124846408) is 3-[[2-[(3S)-3-ethyl-3-methylmorpholin-4-yl]acetyl]amino]-N,N-dimethylbenzamide.
What is the SMILES notation for 3-[[2-[(3S)-3-ethyl-3-methylmorpholin-4-yl]acetyl]amino]-N,N-dimethylbenzamide?
The canonical SMILES for 3-[[2-[(3S)-3-ethyl-3-methylmorpholin-4-yl]acetyl]amino]-N,N-dimethylbenzamide is CC[C@@]1(C)COCCN1CC(=O)Nc1cccc(C(=O)N(C)C)c1.
What is the InChIKey of 3-[[2-[(3S)-3-ethyl-3-methylmorpholin-4-yl]acetyl]amino]-N,N-dimethylbenzamide?
The InChIKey is ISRYWMCAZWQLJZ-SFHVURJKSA-N. The full InChI is InChI=1S/C18H27N3O3/c1-5-18(2)13-24-10-9-21(18)12-16(22)19-15-8-6-7-14(11-15)17(23)20(3)4/h6-8,11H,5,9-10,12-13H2,1-4H3,(H,19,22)/t18-/m0/s1.
What are the key properties of 3-[[2-[(3S)-3-ethyl-3-methylmorpholin-4-yl]acetyl]amino]-N,N-dimethylbenzamide?
3-[[2-[(3S)-3-ethyl-3-methylmorpholin-4-yl]acetyl]amino]-N,N-dimethylbenzamide has a molecular weight of 333.43 g/mol, XLogP of 1.83, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-[(3S)-3-ethyl-3-methylmorpholin-4-yl]acetyl]amino]-N,N-dimethylbenzamide is sourced from PubChem (CID 124846408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).