C14H15FN2OS — CID 124851478
(2S,6R)-4-(5-fluoro-2-pyridinyl)-2-methyl-6-thiophen-3-ylmorpholine (PubChem CID 124851478) has the molecular formula C14H15FN2OS and a molecular weight of 278.35 g/mol. Its IUPAC name is (2S,6R)-4-(5-fluoro-2-pyridinyl)-2-methyl-6-thiophen-3-ylmorpholine.
| Compound Name | (2S,6R)-4-(5-fluoro-2-pyridinyl)-2-methyl-6-thiophen-3-ylmorpholine |
|---|---|
| PubChem CID | 124851478 |
| Molecular Formula | C14H15FN2OS |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (2S,6R)-4-(5-fluoro-2-pyridinyl)-2-methyl-6-thiophen-3-ylmorpholine |
| SMILES | C[C@H]1CN(c2ccc(F)cn2)C[C@@H](c2ccsc2)O1 |
| InChI | InChI=1S/C14H15FN2OS/c1-10-7-17(14-3-2-12(15)6-16-14)8-13(18-10)11-4-5-19-9-11/h2-6,9-10,13H,7-8H2,1H3/t10-,13-/m0/s1 |
| InChIKey | SJVIKIADCLFBFS-GWCFXTLKSA-N |
| XLogP | 3.25 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |