C17H16FN3OS — CID 133379376
4-(6-fluoroquinazolin-4-yl)-2-methyl-6-thiophen-3-ylmorpholine (PubChem CID 133379376) has the molecular formula C17H16FN3OS and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-(6-fluoroquinazolin-4-yl)-2-methyl-6-thiophen-3-ylmorpholine.
| Compound Name | 4-(6-fluoroquinazolin-4-yl)-2-methyl-6-thiophen-3-ylmorpholine |
|---|---|
| PubChem CID | 133379376 |
| Molecular Formula | C17H16FN3OS |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 4-(6-fluoroquinazolin-4-yl)-2-methyl-6-thiophen-3-ylmorpholine |
| SMILES | CC1CN(c2ncnc3ccc(F)cc23)CC(c2ccsc2)O1 |
| InChI | InChI=1S/C17H16FN3OS/c1-11-7-21(8-16(22-11)12-4-5-23-9-12)17-14-6-13(18)2-3-15(14)19-10-20-17/h2-6,9-11,16H,7-8H2,1H3 |
| InChIKey | HJTCIHNFQQROON-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |