C16H26N4OS — CID 124852369
N-methyl-N-[(2S)-1-pyrazin-2-ylpropan-2-yl]-2-(2-pyrrolidin-1-ylethylsulfanyl)acetamide (PubChem CID 124852369) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is N-methyl-N-[(2S)-1-pyrazin-2-ylpropan-2-yl]-2-(2-pyrrolidin-1-ylethylsulfanyl)acetamide.
| Compound Name | N-methyl-N-[(2S)-1-pyrazin-2-ylpropan-2-yl]-2-(2-pyrrolidin-1-ylethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 124852369 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-methyl-N-[(2S)-1-pyrazin-2-ylpropan-2-yl]-2-(2-pyrrolidin-1-ylethylsulfanyl)acetamide |
| SMILES | C[C@@H](Cc1cnccn1)N(C)C(=O)CSCCN1CCCC1 |
| InChI | InChI=1S/C16H26N4OS/c1-14(11-15-12-17-5-6-18-15)19(2)16(21)13-22-10-9-20-7-3-4-8-20/h5-6,12,14H,3-4,7-11,13H2,1-2H3/t14-/m0/s1 |
| InChIKey | URBYFMZCUQLGRG-AWEZNQCLSA-N |
| XLogP | 1.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|